Systematic / IUPAC Name: 2-(Methylsulfanyl)[1,3]thiazolo[5,4-d]pyrimidine-5,7(4H,6H)-dithione
ID: Reference4041
Other Names: 2-(Methylthio)[1,3]thiazolo[5,4-d]pyrimidine-5,7-dithiol
Formula: C6H5N3S4
2-(Methylthio)-4,5,6,7-tetrahydropyrimido[5,4-d][1,3]thiazole-5,7-dithione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/2/2016 2:08:00 PM |
| InChI | InChI=1S/C6H5N3S4/c1-12-6-7-2-3(10)8-5(11)9-4(2)13-6/h1H3,(H2,8,9,10,11) |
| InChI Key | YVFHEBZPVMDKEG-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=NC2=C(S1)NC(=S)NC2=S |
| CAS | 73109394 |
| Splash | |
| Other Names | 2-(Methylthio)[1,3]thiazolo[5,4-d]pyrimidine-5,7-dithiol |
| ChemSpider | 2081214 |
| PubChem | 2802538 |
| ChemIDPlus | 073109394 |
| ChEMBL | CHEMBL1990014 |