Systematic / IUPAC Name: 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 2,4-dichlorobenzoate
ID: Reference4049
Other Names:
2,4-Dichloro-benzoic acid 2-(2-methyl-5-nitro-imidazol-1-yl)-ethyl ester;
Benzoic acid, 2,4-dichloro-, 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl ester
Formula: C13H11Cl2N3O4
2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 2,4-dichlorobenzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 184 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/3/2016 10:56:35 AM |
| InChI | InChI=1S/C13H11Cl2N3O4/c1-8-16-7-12(18(20)21)17(8)4-5-22-13(19)10-3-2-9(14)6-11(10)15/h2-3,6-7H,4-5H2,1H3 |
| InChI Key | UPOGOBRIGAKYDA-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
2,4-Dichloro-benzoic acid 2-(2-methyl-5-nitro-imidazol-1-yl)-ethyl ester; Benzoic acid, 2,4-dichloro-, 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl ester |
| ChemSpider | 635026 |
| ChEMBL | CHEMBL1313951 |
| PubChem | 727185 |