Systematic / IUPAC Name: 3-Amino-2-methylpropanoic acid
ID: Reference405
Other Names:
DL-3-Aminoisobutyric acid;
DL-β-Aminoisobutyric acid;
DL-3-Amino-2-methylpropionic acid;
3-Aminoisobutanoate;
2-(Aminomethyl)propionic acid
; more
Formula: C4H9NO2
Class: Endogenous Metabolites
DL-3-Aminoisobutyric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 4 |
| No. of Spectra | 336 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/11/2016 11:26:01 AM |
| InChI | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| InChI Key | QCHPKSFMDHPSNR-UHFFFAOYSA-N |
| Canonical SMILES | CC(CN)C(=O)O |
| CAS | 144901 |
| Splash | |
| Other Names |
DL-3-Aminoisobutyric acid; DL-β-Aminoisobutyric acid; DL-3-Amino-2-methylpropionic acid; 3-Aminoisobutanoate; 2-(Aminomethyl)propionic acid; 3-Aminoisobutanoic acid; Propanoic acid, 3-amino-2-methyl-; DL-2-Methyl-β-alanine; Isobutanoic acid, 3-amino-; 3-Amino-2-methylpropanoate; 3-Aminoisobutyrate; 2-Methyl-3-aminopropionic acid; 3-Amino-2-methylpropionic acid; DL-3-Amino-2-methylpropanoic acid |
| HMDb | HMDB03911 |
| PubChem | 64956 |
| Wikipedia | 3-Aminoisobutyric acid |
| KEGG | C05145 |
| ChEBI | CHEBI:27389 |
| ChemIDPlus | 000144901; 010569729 |
| ChemSpider | 58481 |