Systematic / IUPAC Name: Methyl 5-{[4-(4-chlorophenyl)-4-hydroxy-1-piperidinyl]sulfonyl}-1-methyl-1H-pyrrole-2-carboxylate
ID: Reference4053
Other Names:
1H-Pyrrole-2-carboxylic acid, 5-{[4-(4-chlorophenyl)-4-hydroxy-1-piperidinyl]sulfonyl}-1-methyl-, methyl ester ;
Methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidine-1-sulfonyl]-1-methyl-1H-pyrrole-2-carboxylate
Formula: C18H21ClN2O5S
Methyl 5-{[4-(4-chlorophenyl)-4-hydroxypiperidino]sulfonyl}-1-methyl-1H-pyrrole-2-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 201 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/3/2016 10:41:33 AM |
| InChI | InChI=1S/C18H21ClN2O5S/c1-20-15(17(22)26-2)7-8-16(20)27(24,25)21-11-9-18(23,10-12-21)13-3-5-14(19)6-4-13/h3-8,23H,9-12H2,1-2H3 |
| InChI Key | ZDKAATXNULNDFP-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=CC=C1S(=O)(=O)N2CCC(CC2)(C3=CC=C(C=C3)Cl)O)C(=O)OC |
| CAS | |
| Splash | |
| Other Names |
1H-Pyrrole-2-carboxylic acid, 5-{[4-(4-chlorophenyl)-4-hydroxy-1-piperidinyl]sulfonyl}-1-methyl-, methyl ester ; Methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidine-1-sulfonyl]-1-methyl-1H-pyrrole-2-carboxylate |