Systematic / IUPAC Name: 7-Methyl-2-phenyl-4-quinolinecarboxylic acid
ID: Reference4055
Other Names: 4-Quinolinecarboxylic acid,7-methyl-2-phenyl-
Formula: C17H13NO2
7-Methyl-2-phenylquinoline-4-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 177 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/3/2016 12:29:17 PM |
| InChI | InChI=1S/C17H13NO2/c1-11-7-8-13-14(17(19)20)10-15(18-16(13)9-11)12-5-3-2-4-6-12/h2-10H,1H3,(H,19,20) |
| InChI Key | FTDDWOPSQXABQF-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)C(=CC(=N2)C3=CC=CC=C3)C(=O)O |
| CAS | 181048544 |
| Splash | |
| Other Names | 4-Quinolinecarboxylic acid,7-methyl-2-phenyl- |