Systematic / IUPAC Name: 2-Chloro-3-(octylamino)-1,4-naphthoquinone
ID: Reference4058
Other Names: 1,4-Naphthalenedione, 2-chloro-3-(octylamino)-
Formula: C18H22ClNO2
2-Chloro-3-(octylamino)-1,4-dihydronaphthalene-1,4-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/3/2016 1:54:45 PM |
| InChI | InChI=1S/C18H22ClNO2/c1-2-3-4-5-6-9-12-20-16-15(19)17(21)13-10-7-8-11-14(13)18(16)22/h7-8,10-11,20H,2-6,9,12H2,1H3 |
| InChI Key | QEFIUSZAQVMYNY-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCNC1=C(C(=O)C2=CC=CC=C2C1=O)Cl |
| CAS | |
| Splash | |
| Other Names | 1,4-Naphthalenedione, 2-chloro-3-(octylamino)- |