Systematic / IUPAC Name: 5-Chloro-2-{[(6-methyl-3,4-dihydro-1(2H)-quinolinyl)acetyl]amino}-N-(2-thienylmethyl)benzamide
ID: Reference4059
Other Names: 1(2H)-Quinolineacetamide, N-(4-chloro-2-{[(2-thienylmethyl)amino]carbonyl}phenyl)-3,4-dihydro-6-methyl-
Formula: C24H24ClN3O2S
5-Chloro-2-({2-[6-methyl-3,4-dihydro-1(2H)-quinolinyl]acetyl}amino)-N-(2-thienylmethyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/3/2016 1:50:35 PM |
| InChI | InChI=1S/C24H24ClN3O2S/c1-16-6-9-22-17(12-16)4-2-10-28(22)15-23(29)27-21-8-7-18(25)13-20(21)24(30)26-14-19-5-3-11-31-19/h3,5-9,11-13H,2,4,10,14-15H2,1H3,(H,26,30)(H,27,29) |
| InChI Key | ANUIXJNHIOHPAS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N(CCC2)CC(=O)NC3=C(C=C(C=C3)Cl)C(=O)NCC4=CC=CS4 |
| CAS | |
| Splash | |
| Other Names | 1(2H)-Quinolineacetamide, N-(4-chloro-2-{[(2-thienylmethyl)amino]carbonyl}phenyl)-3,4-dihydro-6-methyl- |