Systematic / IUPAC Name: 2,3-Dihydroxypropyl palmitate
ID: Reference406
Other Names:
Hexadecanoic acid, 2,3-dihydroxypropyl ester;
Palmitic acid α-monoglyceride;
Rac-2,3-dihydroxypropyl palmitate;
Rac-palmitic acid α-monoglyceride;
Rac-2,3-dihydroxypropyl hexadecanoate
; more
Formula: C19H38O4
Class: Endogenous Metabolites
1-Palmitoylglycerol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1165 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 7/22/2025 12:09:18 PM |
| InChI | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3 |
| InChI Key | QHZLMUACJMDIAE-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCCCCCCCC(=O)OCC(CO)O |
| CAS | 542449 |
| Splash | |
| Other Names |
Hexadecanoic acid, 2,3-dihydroxypropyl ester; Palmitic acid α-monoglyceride; Rac-2,3-dihydroxypropyl palmitate; Rac-palmitic acid α-monoglyceride; Rac-2,3-dihydroxypropyl hexadecanoate; 1-Monopalmitin; Glycerol 1-palmitate; 1-Monopalmitoylglycerol; α-Monopalmitin; Glycerol 1-monopalmitate; Glyceryl palmitate; Rac-glycerol 1-palmitate; 1-Hexadecanoyl-rac-glycerol; 1-Monohexadecanoyl-rac-glycerol; DL-α-Palmitin; Rac-α-monopalmitin; Rac-glyceryl palmitate; 3-Palmitoyl-rac-glycerol; Rac-glycerol 1-monopalmitate |
| ChEMBL | CHEMBL1078140 |
| ChemIDPlus | 001330730; 008044700; 000542449; 068002700; 032899415 |
| PubChem | 14900 |
| ChEBI | CHEBI:69081; CHEBI:75811 |
| ChemSpider | 14201 |
| LipidsMAPs | LMGL01010001 |