Systematic / IUPAC Name: 1-(4-Chlorophenyl)-6-hydroxy-3,4,4,6-tetramethyltetrahydro-2(1H)-pyrimidinone
ID: Reference4060
Other Names:
1-(4-Chlorophenyl)-6-hydroxy-3,4,4,6-tetramethyltetrahydropyrimidin-2(1H)-one;
2(1H)-Pyrimidinone, 1-(4-chlorophenyl)tetrahydro-6-hydroxy-3,4,4,6-tetramethyl-
Formula: C14H19ClN2O2
1-(4-Chlorophenyl)-6-hydroxy-3,4,4,6-tetramethylhexahydropyrimidin-2-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/3/2016 2:10:18 PM |
| InChI | InChI=1S/C14H19ClN2O2/c1-13(2)9-14(3,19)17(12(18)16(13)4)11-7-5-10(15)6-8-11/h5-8,19H,9H2,1-4H3 |
| InChI Key | SSHPBKHRMZJGAB-UHFFFAOYSA-N |
| Canonical SMILES | CC1(CC(N(C(=O)N1C)C2=CC=C(C=C2)Cl)(C)O)C |
| CAS | |
| Splash | |
| Other Names |
1-(4-Chlorophenyl)-6-hydroxy-3,4,4,6-tetramethyltetrahydropyrimidin-2(1H)-one; 2(1H)-Pyrimidinone, 1-(4-chlorophenyl)tetrahydro-6-hydroxy-3,4,4,6-tetramethyl- |
| PubChem | 2817316 |
| ChEMBL | CHEMBL1881339 |
| ChemSpider | 2095627 |