Systematic / IUPAC Name: N-{[4-(4-Fluorophenyl)-1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]carbamoyl}-4-methylbenzenesulfonamide
ID: Reference4061
Other Names: Benzenesulfonamide, N-({[4-(4-fluorophenyl)-1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]amino}carbonyl)-4-methyl-
Formula: C19H16F4N4O3S
4-(4-Fluorophenyl)-1-methyl-5-[({[(4-methylphenyl)sulfonyl]amino}carbonyl)amino]-3-(trifluoromethyl)-1H-pyrazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 236 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/3/2016 3:08:27 PM |
| InChI | InChI=1S/C19H16F4N4O3S/c1-11-3-9-14(10-4-11)31(29,30)26-18(28)24-17-15(12-5-7-13(20)8-6-12)16(19(21,22)23)25-27(17)2/h3-10H,1-2H3,(H2,24,26,28) |
| InChI Key | LXAINEHNLWZQQD-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=C(C(=NN2C)C(F)(F)F)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names | Benzenesulfonamide, N-({[4-(4-fluorophenyl)-1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]amino}carbonyl)-4-methyl- |