Systematic / IUPAC Name: N-[3-(3-Acetamidophenoxy)propyl]-3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxamide
ID: Reference4063
Other Names: 3-(2-Chloro-6-fluorophenyl)-N-[3-(3-acetamidophenoxy)propyl]-5-methyl-1,2-oxazole-4-carboxamide
Formula: C22H21ClFN3O4
N-{3-[3-(Acetylamino)phenoxy]propyl}-3-(2-chloro-6-fluorophenyl)-5-methyl-4-isoxazolecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2016 7:02:48 AM |
| InChI | InChI=1S/C22H21ClFN3O4/c1-13-19(21(27-31-13)20-17(23)8-4-9-18(20)24)22(29)25-10-5-11-30-16-7-3-6-15(12-16)26-14(2)28/h3-4,6-9,12H,5,10-11H2,1-2H3,(H,25,29)(H,26,28) |
| InChI Key | GMNFRAOTCOWMCO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)F)C(=O)NCCCOC3=CC=CC(=C3)NC(=O)C |
| CAS | |
| Splash | |
| Other Names | 3-(2-Chloro-6-fluorophenyl)-N-[3-(3-acetamidophenoxy)propyl]-5-methyl-1,2-oxazole-4-carboxamide |