Systematic / IUPAC Name: 3-(4-Butylphenyl)-4-(4-fluorophenyl)-1,3-oxazol-2(3H)-one
ID: Reference4064
Other Names: 2(3H)-Oxazolone, 3-(4-butylphenyl)-4-(4-fluorophenyl)-
Formula: C19H18FNO2
3-(4-Butylphenyl)-4-(4-fluorophenyl)-1,3-oxazol-2(3H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2016 7:43:23 AM |
| InChI | InChI=1S/C19H18FNO2/c1-2-3-4-14-5-11-17(12-6-14)21-18(13-23-19(21)22)15-7-9-16(20)10-8-15/h5-13H,2-4H2,1H3 |
| InChI Key | JZZWIIPAIPCTQE-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC1=CC=C(C=C1)N2C(=COC2=O)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names | 2(3H)-Oxazolone, 3-(4-butylphenyl)-4-(4-fluorophenyl)- |