Systematic / IUPAC Name: 3-[(3-Oxo-1,3-dihydro-2-benzofuran-5-yl)carbamoyl]-2-pyrazinecarboxylic acid
ID: Reference4066
Other Names: 2-Pyrazinecarboxylic acid, 3-{[(1,3-dihydro-3-oxo-5-isobenzofuranyl)amino]carbonyl}-
Formula: C14H9N3O5
3-{[(3-Oxo-1,3-dihydro-2-benzofuran-5-yl)amino]carbonyl}-2-pyrazinecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 217 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2016 9:44:08 AM |
| InChI | InChI=1S/C14H9N3O5/c18-12(10-11(13(19)20)16-4-3-15-10)17-8-2-1-7-6-22-14(21)9(7)5-8/h1-5H,6H2,(H,17,18)(H,19,20) |
| InChI Key | RPPQMOPOMKCCDB-UHFFFAOYSA-N |
| Canonical SMILES | C1C2=C(C=C(C=C2)NC(=O)C3=NC=CN=C3C(=O)O)C(=O)O1 |
| CAS | |
| Splash | |
| Other Names | 2-Pyrazinecarboxylic acid, 3-{[(1,3-dihydro-3-oxo-5-isobenzofuranyl)amino]carbonyl}- |