Systematic / IUPAC Name: 2-Amino-4-(2-amino-2-carboxyethyl)sulfanylbutanoic acid
ID: Reference407
Other Names:
2-Amino-4-(2-amino-3-hydroxy-3-oxopropyl)sulfanylbutanoic acid;
DL-Cystathionine;
Cystathionine, DL-
Formula: C7H14N2O4S
Class: Endogenous Metabolites
Cystathionine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 204 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/15/2015 2:07:59 PM |
| InChI | InChI=1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
| InChI Key | ILRYLPWNYFXEMH-UHFFFAOYSA-N |
| Canonical SMILES | C(CSCC(C(=O)O)N)C(C(=O)O)N |
| CAS | 535342 |
| Splash | |
| Other Names |
2-Amino-4-(2-amino-3-hydroxy-3-oxopropyl)sulfanylbutanoic acid; DL-Cystathionine; Cystathionine, DL- |
| Wikipedia | Cystathionine |
| ChEBI | CHEBI:17755 |
| ChemSpider | 811 |
| ChEMBL | CHEMBL209241 |
| ChemIDPlus | 000056882; 000535342; 030651435 |
| HMDb | HMDB00455 |
| KEGG | C00542 |
| PubChem | 834 |