Systematic / IUPAC Name: (2E)-{[3,5-Bis(trifluoromethyl)phenyl]hydrazono}(propylsulfonyl)acetonitrile
ID: Reference4081
Other Names: Acetonitrile, 2-{2-[3,5-bis(trifluoromethyl)phenyl]hydrazinylidene}-2-(propylsulfonyl)-, (2E)-
Formula: C13H11F6N3O2S
2-{2-[3,5-Bis(trifluoromethyl)phenyl]hydrazono}-2-(propylsulfonyl)acetonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/7/2016 11:55:04 AM |
| InChI | InChI=1S/C13H11F6N3O2S/c1-2-3-25(23,24)11(7-20)22-21-10-5-8(12(14,15)16)4-9(6-10)13(17,18)19/h4-6,21H,2-3H2,1H3/b22-11+ |
| InChI Key | VCICTSQJDSMSKR-SSDVNMTOSA-N |
| Canonical SMILES | CCCS(=O)(=O)C(=NNC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C#N |
| CAS | |
| Splash | |
| Other Names | Acetonitrile, 2-{2-[3,5-bis(trifluoromethyl)phenyl]hydrazinylidene}-2-(propylsulfonyl)-, (2E)- |