Systematic / IUPAC Name: N-(1-{2-[(4-Chlorophenyl)sulfonyl]hydrazino}-4-methyl-1-oxo-2-pentanyl)-2-(3-thienyl)acetamide
ID: Reference4082
Other Names: N-1-[1-({2-[(4-chlorophenyl)sulfonyl]hydrazino}carbonyl)-3-methylbutyl]-2-(3-thienyl)acetamide
Formula: C18H22ClN3O4S2
N1-[1-({2-[(4-chlorophenyl)sulfonyl]hydrazino}carbonyl)-3-methylbutyl]-2-(3-thienyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/7/2016 11:56:22 AM |
| InChI | InChI=1S/C18H22ClN3O4S2/c1-12(2)9-16(20-17(23)10-13-7-8-27-11-13)18(24)21-22-28(25,26)15-5-3-14(19)4-6-15/h3-8,11-12,16,22H,9-10H2,1-2H3,(H,20,23)(H,21,24) |
| InChI Key | PTKITYDEUDPWNS-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CC(C(=O)NNS(=O)(=O)C1=CC=C(C=C1)Cl)NC(=O)CC2=CSC=C2 |
| CAS | |
| Splash | |
| Other Names | N-1-[1-({2-[(4-chlorophenyl)sulfonyl]hydrazino}carbonyl)-3-methylbutyl]-2-(3-thienyl)acetamide |