Systematic / IUPAC Name: [(2-{[2-Chloro-6-(4-methoxyphenoxy)benzyl]amino}-2-oxoethyl)sulfanyl]acetic acid
ID: Reference4083
Other Names:
2-{[({[2-Chloro-6-(4-methoxyphenoxy)phenyl]methyl}carbamoyl)methyl]sulfanyl}acetic acid;
Acetic acid, 2-{[2-({[2-chloro-6-(4-methoxyphenoxy)phenyl]methyl}amino)-2-oxoethyl]thio}-
Formula: C18H18ClNO5S
2-[(2-{[2-Chloro-6-(4-methoxyphenoxy)benzyl]amino}-2-oxoethyl)sulfanyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 226 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/7/2016 11:48:21 AM |
| InChI | InChI=1S/C18H18ClNO5S/c1-24-12-5-7-13(8-6-12)25-16-4-2-3-15(19)14(16)9-20-17(21)10-26-11-18(22)23/h2-8H,9-11H2,1H3,(H,20,21)(H,22,23) |
| InChI Key | ODOPZFUCLKIIEF-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)OC2=C(C(=CC=C2)Cl)CNC(=O)CSCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
2-{[({[2-Chloro-6-(4-methoxyphenoxy)phenyl]methyl}carbamoyl)methyl]sulfanyl}acetic acid; Acetic acid, 2-{[2-({[2-chloro-6-(4-methoxyphenoxy)phenyl]methyl}amino)-2-oxoethyl]thio}- |
| ChemSpider | 2090732 |
| ChEMBL | CHEMBL1883195 |
| PubChem | 2812327 |