Systematic / IUPAC Name: N'-[(5-Chloro-2-thienyl)sulfonyl]-2-{[2-(phenylsulfonyl)ethyl]sulfanyl}acetohydrazide
ID: Reference4084
Other Names:
N'2-(2-{[2-(Phenylsulfonyl)ethyl]thio}acetyl)-5-chlorothiophene-2-sulfonohydrazide ;
Acetic acid, 2-{[2-(phenylsulfonyl)ethyl]thio}, 2-[(5-chloro-2-thienyl)sulfonyl]hydrazide
Formula: C14H15ClN2O5S4
N'2-(2-{[2-(Phenylsulfonyl)ethyl]thio}acetyl)-5-chlorothiophene-2-sulfonohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/7/2016 1:08:49 PM |
| InChI | InChI=1S/C14H15ClN2O5S4/c15-12-6-7-14(24-12)26(21,22)17-16-13(18)10-23-8-9-25(19,20)11-4-2-1-3-5-11/h1-7,17H,8-10H2,(H,16,18) |
| InChI Key | YFAGIFBFPSPPDI-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)S(=O)(=O)CCSCC(=O)NNS(=O)(=O)C2=CC=C(S2)Cl |
| CAS | |
| Splash | |
| Other Names |
N'2-(2-{[2-(Phenylsulfonyl)ethyl]thio}acetyl)-5-chlorothiophene-2-sulfonohydrazide ; Acetic acid, 2-{[2-(phenylsulfonyl)ethyl]thio}, 2-[(5-chloro-2-thienyl)sulfonyl]hydrazide |