Systematic / IUPAC Name: 3-[(2-Chloro-6-fluorobenzyl)sulfanyl]-4-methyl-5-[2-(2-thienyl)-1,3-thiazol-4-yl]-4H-1,2,4-triazole
ID: Reference4096
Other Names: Thiazole, 4-(5-{[(2-chloro-6-fluorophenyl)methyl]thio}-4-methyl-4H-1,2,4-triazol-3-yl)-2-(2-thienyl)-
Formula: C17H12ClFN4S3
4-{5-[(2-Chloro-6-fluorobenzyl)thio]-4-methyl-4H-1,2,4-triazol-3-yl}-2-(2-thienyl)-1,3-thiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2016 9:40:37 AM |
| InChI | InChI=1S/C17H12ClFN4S3/c1-23-15(13-9-25-16(20-13)14-6-3-7-24-14)21-22-17(23)26-8-10-11(18)4-2-5-12(10)19/h2-7,9H,8H2,1H3 |
| InChI Key | UFLDDOVYKQCMSV-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=NN=C1SCC2=C(C=CC=C2Cl)F)C3=CSC(=N3)C4=CC=CS4 |
| CAS | |
| Splash | |
| Other Names | Thiazole, 4-(5-{[(2-chloro-6-fluorophenyl)methyl]thio}-4-methyl-4H-1,2,4-triazol-3-yl)-2-(2-thienyl)- |