Systematic / IUPAC Name: 6-[(4-Chlorophenyl)sulfanyl]-N-methyl-5-nitro-4-pyrimidinamine
ID: Reference4104
Other Names: 4-Pyrimidinamine, 6-[(4-chlorophenyl)thio]-N-methyl-5-nitro-
Formula: C11H9ClN4O2S
N4-Methyl-6-[(4-chlorophenyl)thio]-5-nitropyrimidin-4-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 184 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2016 1:57:41 PM |
| InChI | InChI=1S/C11H9ClN4O2S/c1-13-10-9(16(17)18)11(15-6-14-10)19-8-4-2-7(12)3-5-8/h2-6H,1H3,(H,13,14,15) |
| InChI Key | YMYWRDQTMJNXIP-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 4-Pyrimidinamine, 6-[(4-chlorophenyl)thio]-N-methyl-5-nitro- |
| ChemSpider | 2100280 |
| ChEMBL | CHEMBL1371754 |
| PubChem | 2822060 |