Systematic / IUPAC Name: N-{6-[(7-Chloro-4-quinazolinyl)oxy]-3-pyridinyl}-2-thiophenesulfonamide
ID: Reference4107
Other Names: N-{6-[(7-Chloroquinazolin-4-yl)oxy]pyridin-3-yl}thiophene-2-sulfonamide
Formula: C17H11ClN4O3S2
N-{6-[(7-Chloro-4-quinazolinyl)oxy]-3-pyridinyl}-2-thiophenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2016 2:02:34 PM |
| InChI | InChI=1S/C17H11ClN4O3S2/c18-11-3-5-13-14(8-11)20-10-21-17(13)25-15-6-4-12(9-19-15)22-27(23,24)16-2-1-7-26-16/h1-10,22H |
| InChI Key | HNTVDIRMFQGDLL-UHFFFAOYSA-N |
| Canonical SMILES | C1=CSC(=C1)S(=O)(=O)NC2=CN=C(C=C2)OC3=NC=NC4=C3C=CC(=C4)Cl |
| CAS | |
| Splash | |
| Other Names | N-{6-[(7-Chloroquinazolin-4-yl)oxy]pyridin-3-yl}thiophene-2-sulfonamide |