Systematic / IUPAC Name: Methyl 2,5-dimethyl-4-(phenylsulfamoyl)-3-furoate
ID: Reference4111
Other Names: Methyl 2,5-dimethyl-4-(phenylsulfamoyl)furan-3-carboxylate
Formula: C14H15NO5S
Methyl 4-(anilinosulfonyl)-2,5-dimethyl-3-furoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2016 8:09:05 AM |
| InChI | InChI=1S/C14H15NO5S/c1-9-12(14(16)19-3)13(10(2)20-9)21(17,18)15-11-7-5-4-6-8-11/h4-8,15H,1-3H3 |
| InChI Key | IDRPNQBDXSCXPK-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=C(O1)C)S(=O)(=O)NC2=CC=CC=C2)C(=O)OC |
| CAS | |
| Splash | |
| Other Names | Methyl 2,5-dimethyl-4-(phenylsulfamoyl)furan-3-carboxylate |
| ChEMBL | CHEMBL1904617 |
| PubChem | 2742988 |
| ChemSpider | 2024514 |