Systematic / IUPAC Name: 1-Adamantan-1-yl-3-[2-(methylsulfanyl)benzyl]urea
ID: Reference4120
Other Names:
N-(1-Adamantyl)-N'-[2-(methylthio)benzyl]urea ;
Urea, N-{[2-(methylthio)phenyl]methyl}-N'-tricyclo[3.3.1.13,7]dec-1-yl-
Formula: C19H26N2OS
N-(1-Adamantyl)-N'-[2-(methylthio)benzyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 184 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2016 12:49:40 PM |
| InChI | InChI=1S/C19H26N2OS/c1-23-17-5-3-2-4-16(17)12-20-18(22)21-19-9-13-6-14(10-19)8-15(7-13)11-19/h2-5,13-15H,6-12H2,1H3,(H2,20,21,22) |
| InChI Key | WPXRUUMUUGRZGQ-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=CC=CC=C1CNC(=O)NC23CC4CC(C2)CC(C4)C3 |
| CAS | |
| Splash | |
| Other Names |
N-(1-Adamantyl)-N'-[2-(methylthio)benzyl]urea ; Urea, N-{[2-(methylthio)phenyl]methyl}-N'-tricyclo[3.3.1.13,7]dec-1-yl- |