Systematic / IUPAC Name: 2-(1H-Benzotriazol-1-yl)-N-{2-[(2-furylmethyl)sulfanyl]ethyl}acetamide
ID: Reference4123
Other Names: 2-(1H-1,2,3-Benzotriazol-1-yl)-N-{2-[(2-furylmethyl)thio]ethyl}acetamide
Formula: C15H16N4O2S
2-(1H-1,2,3-Benzotriazol-1-yl)-N-{2-[(2-furylmethyl)thio]ethyl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2016 1:26:29 PM |
| InChI | InChI=1S/C15H16N4O2S/c20-15(16-7-9-22-11-12-4-3-8-21-12)10-19-14-6-2-1-5-13(14)17-18-19/h1-6,8H,7,9-11H2,(H,16,20) |
| InChI Key | UCFSWBUWBQLNEJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)N=NN2CC(=O)NCCSCC3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names | 2-(1H-1,2,3-Benzotriazol-1-yl)-N-{2-[(2-furylmethyl)thio]ethyl}acetamide |