Systematic / IUPAC Name: N-{2-[(7-Methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl}-4-(trifluoromethyl)benzenesulfonamide
ID: Reference4128
Other Names: Benzenesulfonamide, N-{2-[(2,3-dihydro-7-methyl-1H-inden-4-yl)oxy]-3-pyridinyl}-4-(trifluoromethyl)-
Formula: C22H19F3N2O3S
N-{2-[(7-Methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl}-4-(trifluoromethyl)benzenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2016 2:50:32 PM |
| InChI | InChI=1S/C22H19F3N2O3S/c1-14-7-12-20(18-5-2-4-17(14)18)30-21-19(6-3-13-26-21)27-31(28,29)16-10-8-15(9-11-16)22(23,24)25/h3,6-13,27H,2,4-5H2,1H3 |
| InChI Key | YFGSYLNTSUITAI-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C2CCCC2=C(C=C1)OC3=C(C=CC=N3)NS(=O)(=O)C4=CC=C(C=C4)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Benzenesulfonamide, N-{2-[(2,3-dihydro-7-methyl-1H-inden-4-yl)oxy]-3-pyridinyl}-4-(trifluoromethyl)- |