Systematic / IUPAC Name: 1-Methyl-3-(2-methyl-1,3-benzoxazol-6-yl)urea
ID: Reference4131
Other Names:
N-Methyl-N'-(2-methyl-1,3-benzoxazol-6-yl)urea ;
Urea, N-methyl-N'-(2-methyl-6-benzoxazolyl)-
Formula: C10H11N3O2
N-Methyl-N'-(2-methyl-1,3-benzoxazol-6-yl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 204 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2016 8:49:21 AM |
| InChI | InChI=1S/C10H11N3O2/c1-6-12-8-4-3-7(5-9(8)15-6)13-10(14)11-2/h3-5H,1-2H3,(H2,11,13,14) |
| InChI Key | RYDBLBQQKQBVJV-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NC2=C(O1)C=C(C=C2)NC(=O)NC |
| CAS | |
| Splash | |
| Other Names |
N-Methyl-N'-(2-methyl-1,3-benzoxazol-6-yl)urea ; Urea, N-methyl-N'-(2-methyl-6-benzoxazolyl)- |
| ChemSpider | 2102261 |
| PubChem | 2824070 |
| ChEMBL | CHEMBL1388723 |