Systematic / IUPAC Name: 1,2,4-Oxadiazol-3-ylmethyl 4-morpholinecarbodithioate
ID: Reference4135
Other Names: 4-Morpholinecarbodithioic acid, 1,2,4-oxadiazol-3-ylmethyl ester
Formula: C8H11N3O2S2
1,2,4-Oxadiazol-3-ylmethyl morpholine-4-carbodithioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 55 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2016 9:05:43 AM |
| InChI | InChI=1S/C8H11N3O2S2/c14-8(11-1-3-12-4-2-11)15-5-7-9-6-13-10-7/h6H,1-5H2 |
| InChI Key | NHOHQAQVLJJLQP-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1C(=S)SCC2=NOC=N2 |
| CAS | |
| Splash | |
| Other Names | 4-Morpholinecarbodithioic acid, 1,2,4-oxadiazol-3-ylmethyl ester |