Systematic / IUPAC Name: 1-[4-(2-Amino-4-pyrimidinyl)phenyl]-3-(3-chlorophenyl)urea
ID: Reference4138
Other Names: Urea, N-[4-(2-amino-4-pyrimidinyl)phenyl]-N'-(3-chlorophenyl)-
Formula: C17H14ClN5O
N-[4-(2-Aminopyrimidin-4-yl)phenyl]-N'-(3-chlorophenyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2016 11:51:20 AM |
| InChI | InChI=1S/C17H14ClN5O/c18-12-2-1-3-14(10-12)22-17(24)21-13-6-4-11(5-7-13)15-8-9-20-16(19)23-15/h1-10H,(H2,19,20,23)(H2,21,22,24) |
| InChI Key | XEPONOORCIXARG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)Cl)NC(=O)NC2=CC=C(C=C2)C3=NC(=NC=C3)N |
| CAS | |
| Splash | |
| Other Names | Urea, N-[4-(2-amino-4-pyrimidinyl)phenyl]-N'-(3-chlorophenyl)- |