Systematic / IUPAC Name: 9-Methyl-7-phenylpyrido[3',2':4,5]furo[3,2-d]pyrimidin-4(1H)-one
ID: Reference4141
Other Names: Pyrido[3',2':4,5]furo[3,2-d]pyrimidin-4(1H)-one, 9-methyl-7-phenyl-
Formula: C16H11N3O2
9-Methyl-7-phenylpyrido[3',2':4,5]furo[3,2-d]pyrimidin-4(3H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 230 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2016 10:18:08 AM |
| InChI | InChI=1S/C16H11N3O2/c1-9-7-11(10-5-3-2-4-6-10)19-16-12(9)13-14(21-16)15(20)18-8-17-13/h2-8H,1H3,(H,17,18,20) |
| InChI Key | NRBIJKKJEFQBEP-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=NC2=C1C3=C(O2)C(=O)N=CN3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | Pyrido[3',2':4,5]furo[3,2-d]pyrimidin-4(1H)-one, 9-methyl-7-phenyl- |