Systematic / IUPAC Name: 5-(1-{[3,5-Bis(trifluoromethyl)phenyl]sulfonyl}-1H-pyrazol-3-yl)-2,4-dimethyl-1,3-oxazole
ID: Reference4146
Other Names: Oxazole, 5-[1-[[3,5-bis(trifluoromethyl)phenyl]sulfonyl]-1H-pyrazol-3-yl]-2,4-dimethyl-
Formula: C16H11F6N3O3S
5-(1-{[3,5-Bis(trifluoromethyl)phenyl]sulfonyl}-1H-pyrazol-3-yl)-2,4-dimethyl-1,3-oxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 65 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2016 12:59:54 PM |
| InChI | InChI=1S/C16H11F6N3O3S/c1-8-14(28-9(2)23-8)13-3-4-25(24-13)29(26,27)12-6-10(15(17,18)19)5-11(7-12)16(20,21)22/h3-7H,1-2H3 |
| InChI Key | JJXYOQIUAZRIBA-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(OC(=N1)C)C2=NN(C=C2)S(=O)(=O)C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Oxazole, 5-[1-[[3,5-bis(trifluoromethyl)phenyl]sulfonyl]-1H-pyrazol-3-yl]-2,4-dimethyl- |