Systematic / IUPAC Name: (E)-1-[3-(4-Chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]-N-[3-(methylsulfanyl)-5-(4-pyridinyl)-4H-1,2,4-triazol-4-yl]methanimine
ID: Reference4150
Other Names: N-{[3-(4-Chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]methylene}-3-(methylsulfanyl)-5-(4-pyridinyl)-4H-1,2,4-triazol-4-amine
Formula: C24H18ClN7S
N-{[3-(4-Chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]methylene}-3-(methylsulfanyl)-5-(4-pyridinyl)-4H-1,2,4-triazol-4-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 190 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2016 1:58:40 PM |
| InChI | InChI=1S/C24H18ClN7S/c1-33-24-29-28-23(18-11-13-26-14-12-18)32(24)27-15-19-16-31(21-5-3-2-4-6-21)30-22(19)17-7-9-20(25)10-8-17/h2-16H,1H3/b27-15+ |
| InChI Key | ZFAPZTVIEFOANF-JFLMPSFJSA-N |
| Canonical SMILES | CSC1=NN=C(N1N=CC2=CN(N=C2C3=CC=C(C=C3)Cl)C4=CC=CC=C4)C5=CC=NC=C5 |
| CAS | |
| Splash | |
| Other Names | N-{[3-(4-Chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]methylene}-3-(methylsulfanyl)-5-(4-pyridinyl)-4H-1,2,4-triazol-4-amine |
| PubChem | 9583948 |
| ChEMBL | CHEMBL3212529 |
| ChemSpider | 7858095 |