Systematic / IUPAC Name: N-(3-Methyl-1-phenyl-1H-pyrazol-5-yl)-2-{[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide
ID: Reference4156
Other Names: Acetamide, N-(3-methyl-1-phenyl-1H-pyrazol-5-yl)-2-{[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio}-
Formula: C25H21N7OS
N-(3-Methyl-1-phenyl-1H-pyrazol-5-yl)-2-{[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2016 7:05:41 AM |
| InChI | InChI=1S/C25H21N7OS/c1-18-16-22(32(30-18)21-10-6-3-7-11-21)27-23(33)17-34-25-29-28-24(19-12-14-26-15-13-19)31(25)20-8-4-2-5-9-20/h2-16H,17H2,1H3,(H,27,33) |
| InChI Key | ISZDZQAOTFPPTK-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN(C(=C1)NC(=O)CSC2=NN=C(N2C3=CC=CC=C3)C4=CC=NC=C4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-(3-methyl-1-phenyl-1H-pyrazol-5-yl)-2-{[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio}- |