Systematic / IUPAC Name: Ethyl [(5-oxo-4,6-diphenyl-4,5-dihydro-1,2,4-triazin-3-yl)sulfanyl]acetate
ID: Reference4162
Other Names:
Acetic acid, 2-[(4,5-dihydro-5-oxo-4,6-diphenyl-1,2,4-triazin-3-yl)thio]-, ethyl ester;
Ethyl 2-[(5-oxo-4,6-diphenyl-4,5-dihydro-1,2,4-triazin-3-yl)sulfanyl]acetate
Formula: C19H17N3O3S
Ethyl 2-[(5-oxo-4,6-diphenyl-4,5-dihydro-1,2,4-triazin-3-yl)thio]acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 214 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2016 9:23:24 AM |
| InChI | InChI=1S/C19H17N3O3S/c1-2-25-16(23)13-26-19-21-20-17(14-9-5-3-6-10-14)18(24)22(19)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| InChI Key | LCEWHOWQVDUWLB-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)CSC1=NN=C(C(=O)N1C2=CC=CC=C2)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
Acetic acid, 2-[(4,5-dihydro-5-oxo-4,6-diphenyl-1,2,4-triazin-3-yl)thio]-, ethyl ester; Ethyl 2-[(5-oxo-4,6-diphenyl-4,5-dihydro-1,2,4-triazin-3-yl)sulfanyl]acetate |