Systematic / IUPAC Name: 4-Methyl-N-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]benzenesulfonamide
ID: Reference4168
Other Names: Benzenesulfonamide, 4-methyl-N-[(5-methyl-3-phenyl-4-isoxazolyl)methyl]-
Formula: C18H18N2O3S
4-Methyl-N-[(5-methyl-3-phenyl-4-isoxazolyl)methyl]benzenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2016 11:37:23 AM |
| InChI | InChI=1S/C18H18N2O3S/c1-13-8-10-16(11-9-13)24(21,22)19-12-17-14(2)23-20-18(17)15-6-4-3-5-7-15/h3-11,19H,12H2,1-2H3 |
| InChI Key | FSSWHIRKCWZLKL-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCC2=C(ON=C2C3=CC=CC=C3)C |
| CAS | |
| Splash | |
| Other Names | Benzenesulfonamide, 4-methyl-N-[(5-methyl-3-phenyl-4-isoxazolyl)methyl]- |
| ChemSpider | 2019796 |
| ChEMBL | CHEMBL1457179 |
| PubChem | 2738171 |