Systematic / IUPAC Name: 1-(2,4-Dichlorobenzyl)-2-[(2,4-dichlorobenzyl)sulfanyl]-1H-benzimidazole
ID: Reference4169
Other Names: 1H-Benzimidazole, 1-[(2,4-dichlorophenyl)methyl]-2-{[(2,4-dichlorophenyl)methyl]thio}-
Formula: C21H14Cl4N2S
1-(2,4-Dichlorobenzyl)-2-[(2,4-dichlorobenzyl)sulfanyl]-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2016 11:09:47 AM |
| InChI | InChI=1S/C21H14Cl4N2S/c22-15-7-5-13(17(24)9-15)11-27-20-4-2-1-3-19(20)26-21(27)28-12-14-6-8-16(23)10-18(14)25/h1-10H,11-12H2 |
| InChI Key | YZMUSWXWFUCTLM-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)N=C(N2CC3=C(C=C(C=C3)Cl)Cl)SCC4=C(C=C(C=C4)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | 1H-Benzimidazole, 1-[(2,4-dichlorophenyl)methyl]-2-{[(2,4-dichlorophenyl)methyl]thio}- |