Systematic / IUPAC Name: 1-(1-Benzothiophen-3-yl)-3-(4-fluorophenyl)urea
ID: Reference4175
Other Names:
3-(1-Benzothiophen-3-yl)-1-(4-fluorophenyl)urea;
Urea, N-benzo[b]thien-3-yl-N'-(4-fluorophenyl)-
Formula: C15H11FN2OS
N-(1-Benzothiophen-3-yl)-N'-(4-fluorophenyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 230 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2016 1:11:54 PM |
| InChI | InChI=1S/C15H11FN2OS/c16-10-5-7-11(8-6-10)17-15(19)18-13-9-20-14-4-2-1-3-12(13)14/h1-9H,(H2,17,18,19) |
| InChI Key | WMWQSAAUEXJUOS-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CS2)NC(=O)NC3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names |
3-(1-Benzothiophen-3-yl)-1-(4-fluorophenyl)urea; Urea, N-benzo[b]thien-3-yl-N'-(4-fluorophenyl)- |
| ChemSpider | 2094637 |
| PubChem | 2816297 |
| ChEMBL | CHEMBL1387157 |