Systematic / IUPAC Name: 2,2-Dichloro-N-(2,5-dimethoxyphenyl)acetamide
ID: Reference4200
Other Names: Acetamide, N-(2,5-dimethoxyphenyl)-2,2-dichloro-
Formula: C10H11Cl2NO3
N1-(2,5-Dimethoxyphenyl)-2,2-dichloroacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 87 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/14/2016 1:48:00 PM |
| InChI | InChI=1S/C10H11Cl2NO3/c1-15-6-3-4-8(16-2)7(5-6)13-10(14)9(11)12/h3-5,9H,1-2H3,(H,13,14) |
| InChI Key | MRFYBJFXENFYEJ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=C(C=C1)OC)NC(=O)C(Cl)Cl |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-(2,5-dimethoxyphenyl)-2,2-dichloro- |