Systematic / IUPAC Name: 6-Methyl-3-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[5,1-c][1,2,4]triazole
ID: Reference4202
Other Names: 1H-Pyrazolo[5,1-c]-1,2,4-triazole, 6-methyl-3-[4-(trifluoromethyl)phenyl]-
Formula: C12H9F3N4
6-Methyl-3-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[5,1-c][1,2,4]triazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/14/2016 2:25:18 PM |
| InChI | InChI=1S/C12H9F3N4/c1-7-6-10-16-17-11(19(10)18-7)8-2-4-9(5-3-8)12(13,14)15/h2-6,16H,1H3 |
| InChI Key | CLRWSTXVSHNYQX-UHFFFAOYSA-N |
| Canonical SMILES | Cc1cc2[nH]nc(n2n1)c3ccc(cc3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 1H-Pyrazolo[5,1-c]-1,2,4-triazole, 6-methyl-3-[4-(trifluoromethyl)phenyl]- |
| ChemSpider | 17925829 |