Systematic / IUPAC Name: 1-(4-Fluorophenoxy)-3-[(2-{[3-(trifluoromethyl)-2-pyridinyl]amino}ethyl)amino]-2-propanol
ID: Reference4207
Other Names: 2-Propanol, 1-(4-fluorophenoxy)-3-[(2-{[3-(trifluoromethyl)-2-pyridinyl]amino}ethyl)amino]-
Formula: C17H19F4N3O2
1-(4-Fluorophenoxy)-3-[(2-{[3-(trifluoromethyl)-2-pyridyl]amino}ethyl)amino]propan-2-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 7:34:11 AM |
| InChI | InChI=1S/C17H19F4N3O2/c18-12-3-5-14(6-4-12)26-11-13(25)10-22-8-9-24-16-15(17(19,20)21)2-1-7-23-16/h1-7,13,22,25H,8-11H2,(H,23,24) |
| InChI Key | ONWODZGYBGJKFQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(N=C1)NCCNCC(COC2=CC=C(C=C2)F)O)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 2-Propanol, 1-(4-fluorophenoxy)-3-[(2-{[3-(trifluoromethyl)-2-pyridinyl]amino}ethyl)amino]- |
| ChemSpider | 2008032 |
| PubChem | 2725960 |
| ChEMBL | CHEMBL1897705 |