Systematic / IUPAC Name: N-[2-(3-Chlorophenyl)-2-oxoethyl]-4-(trifluoromethyl)nicotinamide
ID: Reference4219
Other Names: 3-Pyridinecarboxamide, N-[2-(3-chlorophenyl)-2-oxoethyl]-4-(trifluoromethyl)-
Formula: C15H10ClF3N2O2
N-[2-(3-Chlorophenyl)-2-oxoethyl]-4-(trifluoromethyl)nicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 8:38:02 AM |
| InChI | InChI=1S/C15H10ClF3N2O2/c16-10-3-1-2-9(6-10)13(22)8-21-14(23)11-7-20-5-4-12(11)15(17,18)19/h1-7H,8H2,(H,21,23) |
| InChI Key | DVVZGKNLWYTUCV-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)Cl)C(=O)CNC(=O)C2=C(C=CN=C2)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinecarboxamide, N-[2-(3-chlorophenyl)-2-oxoethyl]-4-(trifluoromethyl)- |
| ChEMBL | CHEMBL1462551 |
| ChemSpider | 2008996 |
| PubChem | 2726944 |