Systematic / IUPAC Name: (2E)-N-(2,5-Dimethoxyphenyl)-3-{4-[4-(2-methoxyphenyl)-1-piperidinyl]-3-nitrophenyl}acrylamide
ID: Reference4220
Other Names: 2-Propenamide, N-(2,5-dimethoxyphenyl)-3-{4-[4-(2-methoxyphenyl)-1-piperidinyl]-3-nitrophenyl}, (2E)-
Formula: C29H31N3O6
N-(2,5-Dimethoxyphenyl)-3-{4-[4-(2-methoxyphenyl)piperidino]-3-nitrophenyl}acrylamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 8:44:20 AM |
| InChI | InChI=1S/C29H31N3O6/c1-36-22-10-12-28(38-3)24(19-22)30-29(33)13-9-20-8-11-25(26(18-20)32(34)35)31-16-14-21(15-17-31)23-6-4-5-7-27(23)37-2/h4-13,18-19,21H,14-17H2,1-3H3,(H,30,33)/b13-9+ |
| InChI Key | LNESHQSAUNYKJN-UKTHLTGXSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 2-Propenamide, N-(2,5-dimethoxyphenyl)-3-{4-[4-(2-methoxyphenyl)-1-piperidinyl]-3-nitrophenyl}, (2E)- |