Systematic / IUPAC Name: Dimethyl 2,2'-iminodiacetate
ID: Reference4223
Other Names:
Glycine, N-(2-methoxy-2-oxoethyl), methyl ester;
Methyl 2-[(2-methoxy-2-oxoethyl)amino]acetate
Formula: C6H11NO4
Methyl 2-[(2-methoxy-2-oxoethyl)amino]acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 79 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 8:53:33 AM |
| InChI | InChI=1S/C6H11NO4/c1-10-5(8)3-7-4-6(9)11-2/h7H,3-4H2,1-2H3 |
| InChI Key | VNYJDSJLCWDYJK-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)CNCC(=O)OC |
| CAS | |
| Splash | |
| Other Names |
Glycine, N-(2-methoxy-2-oxoethyl), methyl ester; Methyl 2-[(2-methoxy-2-oxoethyl)amino]acetate |