Systematic / IUPAC Name: 1-Benzofuran-2-ylmethyl carbamimidothioate
ID: Reference4228
Other Names: Carbamimidothioic acid, 2-benzofuranylmethyl ester
Formula: C10H10N2OS
Benzo[b]furan-2-ylmethyl aminomethanimidothioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 7:14:56 AM |
| InChI | InChI=1S/C10H10N2OS/c11-10(12)14-6-8-5-7-3-1-2-4-9(7)13-8/h1-5H,6H2,(H3,11,12) |
| InChI Key | JYPUOIMPIXJVJY-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=C(O2)CSC(=N)N |
| CAS | |
| Splash | |
| Other Names | Carbamimidothioic acid, 2-benzofuranylmethyl ester |