Systematic / IUPAC Name: (E)-1-(1,3-Benzodioxol-5-yl)-N-(4,5-dihydronaphtho[1,2-d][1,3]thiazol-2-yl)methanimine
ID: Reference4230
Other Names: Naphtho[1,2-d]thiazol-2-amine, N-[(1E)-1,3-benzodioxol-5-ylmethylene]-4,5-dihydro-
Formula: C19H14N2O2S
N-(1,3-Benzodioxol-5-ylmethylene)-4,5-dihydronaphtho[1,2-d][1,3]thiazol-2-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 81 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 9:26:13 AM |
| InChI | InChI=1S/C19H14N2O2S/c1-2-4-14-13(3-1)6-8-17-18(14)21-19(24-17)20-10-12-5-7-15-16(9-12)23-11-22-15/h1-5,7,9-10H,6,8,11H2/b20-10+ |
| InChI Key | OKKNMODTFZZJRK-KEBDBYFISA-N |
| Canonical SMILES | C1CC2=C(C3=CC=CC=C31)N=C(S2)N=CC4=CC5=C(C=C4)OCO5 |
| CAS | |
| Splash | |
| Other Names | Naphtho[1,2-d]thiazol-2-amine, N-[(1E)-1,3-benzodioxol-5-ylmethylene]-4,5-dihydro- |