Systematic / IUPAC Name: 4-[4-(5-Chloro-1,3-benzothiazol-2-yl)-1-piperazinyl]-2-methylquinoline
ID: Reference4232
Other Names: Quinoline, 4-[4-(5-chloro-2-benzothiazolyl)-1-piperazinyl]-2-methyl-
Formula: C21H19ClN4S
4-[4-(5-Chloro-1,3-benzothiazol-2-yl)piperazino]-2-methylquinoline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 9:29:03 AM |
| InChI | InChI=1S/C21H19ClN4S/c1-14-12-19(16-4-2-3-5-17(16)23-14)25-8-10-26(11-9-25)21-24-18-13-15(22)6-7-20(18)27-21/h2-7,12-13H,8-11H2,1H3 |
| InChI Key | QHWLDFXFRCBDOJ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NC2=CC=CC=C2C(=C1)N3CCN(CC3)C4=NC5=C(S4)C=CC(=C5)Cl |
| CAS | |
| Splash | |
| Other Names | Quinoline, 4-[4-(5-chloro-2-benzothiazolyl)-1-piperazinyl]-2-methyl- |