Systematic / IUPAC Name: 2-(3-Chloro-4-methylphenyl)-6-(methoxymethyl)-5-(2-methyl-2-propen-1-yl)-4-pyrimidinyl dimethylcarbamate
ID: Reference4245
Other Names: Carbamic acid, N,N-dimethyl, 2-(3-chloro-4-methylphenyl)-6-(methoxymethyl)-5-(2-methyl-2-propen-1-yl)-4-pyrimidinyl ester
Formula: C20H24ClN3O3
2-(3-Chloro-4-methylphenyl)-6-(methoxymethyl)-5-(2-methylallyl)pyrimidin-4-yl N,N-dimethylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 1:25:22 PM |
| InChI | InChI=1S/C20H24ClN3O3/c1-12(2)9-15-17(11-26-6)22-18(14-8-7-13(3)16(21)10-14)23-19(15)27-20(25)24(4)5/h7-8,10H,1,9,11H2,2-6H3 |
| InChI Key | OCVZHYVHTZEGBE-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=C(C=C1)C2=NC(=C(C(=N2)OC(=O)N(C)C)CC(=C)C)COC)Cl |
| CAS | |
| Splash | |
| Other Names | Carbamic acid, N,N-dimethyl, 2-(3-chloro-4-methylphenyl)-6-(methoxymethyl)-5-(2-methyl-2-propen-1-yl)-4-pyrimidinyl ester |