Systematic / IUPAC Name: 3,4-Dimethoxyphenyl N,N-dimethyl-3,5-bis(trifluoromethyl)benzenecarbohydrazonothioate
ID: Reference4247
Other Names: Benzenecarbohydrazonothioic acid, N,N-dimethyl-3,5-bis(trifluoromethyl), 3,4-dimethoxyphenyl ester
Formula: C19H18F6N2O2S
1-(3,4-Dimethoxyphenyl) N1,N1-dimethyl-3,5-di(trifluoromethyl)benzene-1-carbohydrazonothioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 2:19:20 PM |
| InChI | InChI=1S/C19H18F6N2O2S/c1-27(2)26-17(30-14-5-6-15(28-3)16(10-14)29-4)11-7-12(18(20,21)22)9-13(8-11)19(23,24)25/h5-10H,1-4H3/b26-17+ |
| InChI Key | SVWSQSSKJARLSX-YZSQISJMSA-N |
| Canonical SMILES | CN(C)N=C(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)SC2=CC(=C(C=C2)OC)OC |
| CAS | |
| Splash | |
| Other Names | Benzenecarbohydrazonothioic acid, N,N-dimethyl-3,5-bis(trifluoromethyl), 3,4-dimethoxyphenyl ester |