Systematic / IUPAC Name: N-Ethyl-4-phenyl-1,3-thiazol-2-amine
ID: Reference4249
Other Names: Ethyl-(4-phenyl-thiazol-2-yl)-amine
Formula: C11H12N2S
N2-Ethyl-4-phenyl-1,3-thiazol-2-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2016 7:39:34 AM |
| InChI | InChI=1S/C11H12N2S/c1-2-12-11-13-10(8-14-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,12,13) |
| InChI Key | GBPDSPQBKICWRK-UHFFFAOYSA-N |
| Canonical SMILES | CCNC1=NC(=CS1)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | Ethyl-(4-phenyl-thiazol-2-yl)-amine |