Systematic / IUPAC Name: N-(2-Fluorophenyl)-2-methyl-6-(trifluoromethyl)nicotinamide
ID: Reference4252
Other Names: 3-Pyridinecarboxamide, N-(2-fluorophenyl)-2-methyl-6-(trifluoromethyl)-
Formula: C14H10F4N2O
N-(2-Fluorophenyl)-2-methyl-6-(trifluoromethyl)nicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2016 7:48:08 AM |
| InChI | InChI=1S/C14H10F4N2O/c1-8-9(6-7-12(19-8)14(16,17)18)13(21)20-11-5-3-2-4-10(11)15/h2-7H,1H3,(H,20,21) |
| InChI Key | MTGGRAPODRYWNG-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=CC(=N1)C(F)(F)F)C(=O)NC2=CC=CC=C2F |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinecarboxamide, N-(2-fluorophenyl)-2-methyl-6-(trifluoromethyl)- |
| ChEMBL | CHEMBL1442446 |
| ChemSpider | 2074775 |
| PubChem | 2795899 |