Systematic / IUPAC Name: N-[2-Chloro-4-({3-[4-(2-chloro-6-fluorobenzyl)-1-piperazinyl]propyl}sulfamoyl)phenyl]acetamide
ID: Reference4253
Other Names: Acetamide, N-(2-chloro-4-{[(3-{4-[(2-chloro-6-fluorophenyl)methyl]-1-piperazinyl}propyl)amino]sulfonyl}phenyl)-
Formula: C22H27Cl2FN4O3S
N-{2-Chloro-4-[({3-[4-(2-chloro-6-fluorobenzyl)piperazino]propyl}amino)sulfonyl]phenyl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2016 7:50:56 AM |
| InChI | InChI=1S/C22H27Cl2FN4O3S/c1-16(30)27-22-7-6-17(14-20(22)24)33(31,32)26-8-3-9-28-10-12-29(13-11-28)15-18-19(23)4-2-5-21(18)25/h2,4-7,14,26H,3,8-13,15H2,1H3,(H,27,30) |
| InChI Key | PFHAEVVTSITXSJ-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC1=C(C=C(C=C1)S(=O)(=O)NCCCN2CCN(CC2)CC3=C(C=CC=C3Cl)F)Cl |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-(2-chloro-4-{[(3-{4-[(2-chloro-6-fluorophenyl)methyl]-1-piperazinyl}propyl)amino]sulfonyl}phenyl)- |